CAS 1993226-94-0 appears in our catalog under these names: cis-5-((tert-Butoxycarbonyl)amino)tetrahydro-2H-pyran-2-carboxylic acid, 97%, cis-5-((tert-Butoxycarbonyl)amino)tetrahydro-2H-pyran-2-carboxylic acid, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 250mg, 1g.
(2R,5R)-5-[(2-methylpropan-2-yl)oxycarbonylamino]oxane-2-carboxylic acid (CAS 1993226-94-0) is a chemical compound with the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. IUPAC name: (2R,5R)-5-[(2-methylpropan-2-yl)oxycarbonylamino]oxane-2-carboxylic acid. InChIKey: NROSRTMHTJHLLE-HTQZYQBOSA-N.
| Molecular formula | C11H19NO5 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | (2R,5R)-5-[(2-methylpropan-2-yl)oxycarbonylamino]oxane-2-carboxylic acid |
| InChIKey | NROSRTMHTJHLLE-HTQZYQBOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC[C@@H](OC1)C(=O)O |
Computed by PubChem (NCBI)