Products 1993278-30-0

CAS 1993278-30-0 is the registry number for Ethyl 2-(4-methoxybenzyl)piperidine-2-carboxylate hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 2-[(4-methoxyphenyl)methyl]piperidine-2-carboxylate;hydrochloride (CAS 1993278-30-0) is a chemical compound with the molecular formula C16H24ClNO3 and a molecular weight of 313.82 g/mol. IUPAC name: ethyl 2-[(4-methoxyphenyl)methyl]piperidine-2-carboxylate;hydrochloride. InChIKey: KRGCFHQCNGTBRC-UHFFFAOYSA-N.

Identity
Molecular formulaC16H24ClNO3
Molecular weight313.82 g/mol
IUPAC nameethyl 2-[(4-methoxyphenyl)methyl]piperidine-2-carboxylate;hydrochloride
InChIKeyKRGCFHQCNGTBRC-UHFFFAOYSA-N
SMILESCCOC(=O)C1(CCCCN1)CC2=CC=C(C=C2)OC.Cl

Computed by PubChem (NCBI)