CAS 1993317-42-2 is the registry number for Cis-4-trifluoromethyl-piperidine-1,2-dicarboxylic acid 1-tert-butyl ester, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
(2R,4S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-(trifluoromethyl)piperidine-2-carboxylic acid (CAS 1993317-42-2) is a chemical compound with the molecular formula C12H18F3NO4 and a molecular weight of 297.27 g/mol. IUPAC name: (2R,4S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-(trifluoromethyl)piperidine-2-carboxylic acid. InChIKey: UNYZILUVCHUWBO-JGVFFNPUSA-N.
| Molecular formula | C12H18F3NO4 |
|---|---|
| Molecular weight | 297.27 g/mol |
| IUPAC name | (2R,4S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-(trifluoromethyl)piperidine-2-carboxylic acid |
| InChIKey | UNYZILUVCHUWBO-JGVFFNPUSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](C[C@@H]1C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)