CAS 199336-83-9 appears in our catalog under these names: (R)–1–Boc–3–(methylamino)pyrrolidine, (R)-3-Methylamino-pyrrolidine-1-carboxylic acid tert-butyl ester, 97%, (R)-tert-Butyl 3-(methylamino)pyrrolidine-1-carboxylate, 97%. Offered by: GLPBio, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 100g.
Tert-butyl (3R)-3-(methylamino)pyrrolidine-1-carboxylate (CAS 199336-83-9) is a chemical compound with the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. IUPAC name: tert-butyl (3R)-3-(methylamino)pyrrolidine-1-carboxylate. InChIKey: OKUCEQDKBKYEJY-MRVPVSSYSA-N.
| Molecular formula | C10H20N2O2 |
|---|---|
| Molecular weight | 200.28 g/mol |
| IUPAC name | tert-butyl (3R)-3-(methylamino)pyrrolidine-1-carboxylate |
| InChIKey | OKUCEQDKBKYEJY-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](C1)NC |
Computed by PubChem (NCBI)