CAS 1993648-57-9 is the registry number for N1-[(1E)-(3-Chlorophenyl)methylene]-4-phenyl-1h-imidazole-1,2-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-[(E)-(3-chlorophenyl)methylideneamino]-4-phenylimidazol-2-amine (CAS 1993648-57-9) is a chemical compound with the molecular formula C16H13ClN4 and a molecular weight of 296.75 g/mol. IUPAC name: 1-[(E)-(3-chlorophenyl)methylideneamino]-4-phenylimidazol-2-amine. InChIKey: QZQWFWDKBHHFIZ-VXLYETTFSA-N.
| Molecular formula | C16H13ClN4 |
|---|---|
| Molecular weight | 296.75 g/mol |
| IUPAC name | 1-[(E)-(3-chlorophenyl)methylideneamino]-4-phenylimidazol-2-amine |
| InChIKey | QZQWFWDKBHHFIZ-VXLYETTFSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN(C(=N2)N)/N=C/C3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)