Products 1994303-24-0

CAS 1994303-24-0 is the registry number for Heptan-4-yl Isobutyl Phthalate. Offered by: TRC. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

2-O-heptan-4-yl 1-O-(2-methylpropyl) benzene-1,2-dicarboxylate (CAS 1994303-24-0) is a chemical compound with the molecular formula C19H28O4 and a molecular weight of 320.4 g/mol. IUPAC name: 2-O-heptan-4-yl 1-O-(2-methylpropyl) benzene-1,2-dicarboxylate. InChIKey: YHUGIMNLJRGFDU-UHFFFAOYSA-N.

Identity
Molecular formulaC19H28O4
Molecular weight320.4 g/mol
IUPAC name2-O-heptan-4-yl 1-O-(2-methylpropyl) benzene-1,2-dicarboxylate
InChIKeyYHUGIMNLJRGFDU-UHFFFAOYSA-N
SMILESCCCC(CCC)OC(=O)C1=CC=CC=C1C(=O)OCC(C)C

Computed by PubChem (NCBI)