CAS 1995068-96-6 is the registry number for NP3-146 (sodium), 99.26%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 25 mg, 100 mg, 10 mg, 5 mg.
CAS 1995068-96-6 identifies a chemical compound with the molecular formula C20H27ClN2NaO5S and a molecular weight of 465.9 g/mol. InChIKey: XJEXORJBPGNCNH-UHFFFAOYSA-N.
| Molecular formula | C20H27ClN2NaO5S |
|---|---|
| Molecular weight | 465.9 g/mol |
| InChIKey | XJEXORJBPGNCNH-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1NC(=O)NS(=O)(=O)C2=CC(=CO2)C(C)(C)O)C(C)C)Cl.[Na] |
Computed by PubChem (NCBI)