CAS 1996082-54-2 is the registry number for 5'-Bromo-4,4-difluoro-3,4,5,6-tetrahydro-2h-[1,2']bipyridinyl-3'-ylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-bromo-2-(4,4-difluoropiperidin-1-yl)pyridin-3-amine (CAS 1996082-54-2) is a chemical compound with the molecular formula C10H12BrF2N3 and a molecular weight of 292.12 g/mol. IUPAC name: 5-bromo-2-(4,4-difluoropiperidin-1-yl)pyridin-3-amine. InChIKey: OLFPBPCSTPFSGI-UHFFFAOYSA-N.
| Molecular formula | C10H12BrF2N3 |
|---|---|
| Molecular weight | 292.12 g/mol |
| IUPAC name | 5-bromo-2-(4,4-difluoropiperidin-1-yl)pyridin-3-amine |
| InChIKey | OLFPBPCSTPFSGI-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1(F)F)C2=C(C=C(C=N2)Br)N |
Computed by PubChem (NCBI)