CAS 199655-36-2 appears in our catalog under these names: 3-(2-Chlorophenyl)-2-[2-[6-[(diethylamino)methyl]-2-pyridinyl]ethenyl]-6-fluoro-4(3H)-quinazolinone, 99+%, 99+%, Cp 465022 hydrochloride, 95%, CP 465022, CP-465022, 99+%, CP 465022/ 98.75% (existing batch purity). Offered by: Chemat, Combi-blocks, TRC, AmBeed, TargetMol. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 5mg, 250mg, 5 mg, 50 mg.
3-(2-chlorophenyl)-2-[(E)-2-[6-(diethylaminomethyl)-2-pyridinyl]ethenyl]-6-fluoroquinazolin-4-one (CAS 199655-36-2) is a chemical compound with the molecular formula C26H24ClFN4O and a molecular weight of 462.9 g/mol. IUPAC name: 3-(2-chlorophenyl)-2-[(E)-2-[6-(diethylaminomethyl)-2-pyridinyl]ethenyl]-6-fluoroquinazolin-4-one. InChIKey: HYHNPUGUPISSQO-FYWRMAATSA-N.
| Molecular formula | C26H24ClFN4O |
|---|---|
| Molecular weight | 462.9 g/mol |
| IUPAC name | 3-(2-chlorophenyl)-2-[(E)-2-[6-(diethylaminomethyl)-2-pyridinyl]ethenyl]-6-fluoroquinazolin-4-one |
| InChIKey | HYHNPUGUPISSQO-FYWRMAATSA-N |
| SMILES | CCN(CC)CC1=NC(=CC=C1)/C=C/C2=NC3=C(C=C(C=C3)F)C(=O)N2C4=CC=CC=C4Cl |
Computed by PubChem (NCBI)