CAS 199673-74-0 appears in our catalog under these names: LY 334370 hydrochloride, LY 334370 hydrochloride, LY334370 (hydrochloride). Offered by: TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 50mg, 2mg, 25mg, Get quote.
4-fluoro-N-[3-(1-methylpiperidin-4-yl)-1H-indol-5-yl]benzamide;hydrochloride (CAS 199673-74-0) is a chemical compound with the molecular formula C21H23ClFN3O and a molecular weight of 387.9 g/mol. IUPAC name: 4-fluoro-N-[3-(1-methylpiperidin-4-yl)-1H-indol-5-yl]benzamide;hydrochloride. InChIKey: DGPDGAPZTPSHBL-UHFFFAOYSA-N.
| Molecular formula | C21H23ClFN3O |
|---|---|
| Molecular weight | 387.9 g/mol |
| IUPAC name | 4-fluoro-N-[3-(1-methylpiperidin-4-yl)-1H-indol-5-yl]benzamide;hydrochloride |
| InChIKey | DGPDGAPZTPSHBL-UHFFFAOYSA-N |
| SMILES | CN1CCC(CC1)C2=CNC3=C2C=C(C=C3)NC(=O)C4=CC=C(C=C4)F.Cl |
Computed by PubChem (NCBI)