CAS 19970-45-7 appears in our catalog under these names: SJ572403, 99+%, SJ572403/ 99.87% (existing batch purity), SJ 403, SJ572403, SJ572403, 98.92%. Offered by: AmBeed, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1g, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
6-ethyl-2,4,7,8-tetramethylpurino[7,8-a]imidazole-1,3-dione (CAS 19970-45-7) is a chemical compound with the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. IUPAC name: 6-ethyl-2,4,7,8-tetramethylpurino[7,8-a]imidazole-1,3-dione. InChIKey: JKJLETUKWLALKV-UHFFFAOYSA-N.
| Molecular formula | C13H17N5O2 |
|---|---|
| Molecular weight | 275.31 g/mol |
| IUPAC name | 6-ethyl-2,4,7,8-tetramethylpurino[7,8-a]imidazole-1,3-dione |
| InChIKey | JKJLETUKWLALKV-UHFFFAOYSA-N |
| SMILES | CCN1C(=C(N2C1=NC3=C2C(=O)N(C(=O)N3C)C)C)C |
Computed by PubChem (NCBI)