Products 19971-73-4
CAS 19971-73-4 is the registry number for S584 (dihydrochloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]benzene-1,2-diol;dihydrochloride (CAS 19971-73-4) is a chemical compound with the molecular formula C15H20Cl2N4O2 and a molecular weight of 359.2 g/mol. IUPAC name: 4-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]benzene-1,2-diol;dihydrochloride. InChIKey: TYWXEMFLSLAZSN-UHFFFAOYSA-N.
| Molecular formula | C15H20Cl2N4O2 |
|---|---|
| Molecular weight | 359.2 g/mol |
| IUPAC name | 4-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]benzene-1,2-diol;dihydrochloride |
| InChIKey | TYWXEMFLSLAZSN-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CC2=CC(=C(C=C2)O)O)C3=NC=CC=N3.Cl.Cl |
Computed by PubChem (NCBI)
Synonyms:
Piribedil Impurity S DiHCl, orb3174937