CAS 1997296-62-4 appears in our catalog under these names: Fluconazole N-Oxide, Fluconazole N-Oxide, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 1mg.
2-(2,4-difluorophenyl)-1-(4-oxido-1,2,4-triazol-4-ium-1-yl)-3-(1,2,4-triazol-1-yl)propan-2-ol (CAS 1997296-62-4) is a chemical compound with the molecular formula C13H12F2N6O2 and a molecular weight of 322.27 g/mol. IUPAC name: 2-(2,4-difluorophenyl)-1-(4-oxido-1,2,4-triazol-4-ium-1-yl)-3-(1,2,4-triazol-1-yl)propan-2-ol. InChIKey: QEEPILPFZHXTDA-UHFFFAOYSA-N.
| Molecular formula | C13H12F2N6O2 |
|---|---|
| Molecular weight | 322.27 g/mol |
| IUPAC name | 2-(2,4-difluorophenyl)-1-(4-oxido-1,2,4-triazol-4-ium-1-yl)-3-(1,2,4-triazol-1-yl)propan-2-ol |
| InChIKey | QEEPILPFZHXTDA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C(CN2C=NC=N2)(CN3C=[N+](C=N3)[O-])O |
Computed by PubChem (NCBI)