CAS 1997864-27-3 is the registry number for 5-(3-Fluoro-4-methylphenyl)oxazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 25g.
5-(3-fluoro-4-methylphenyl)-1,3-oxazole (CAS 1997864-27-3) is a chemical compound with the molecular formula C10H8FNO and a molecular weight of 177.17 g/mol. IUPAC name: 5-(3-fluoro-4-methylphenyl)-1,3-oxazole. InChIKey: UCDKAYCWWKDBBN-UHFFFAOYSA-N.
| Molecular formula | C10H8FNO |
|---|---|
| Molecular weight | 177.17 g/mol |
| IUPAC name | 5-(3-fluoro-4-methylphenyl)-1,3-oxazole |
| InChIKey | UCDKAYCWWKDBBN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=CN=CO2)F |
Computed by PubChem (NCBI)