CAS 199789-54-3 is the registry number for Sodium 3-methyl-2-(methylthio)-4,7-dioxo-3,7-dihydro-4H-pteridin-8-ide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Sodium 3-methyl-2-methylsulfanylpteridin-8-ide-4,7-dione (CAS 199789-54-3) is a chemical compound with the molecular formula C8H7N4NaO2S and a molecular weight of 246.22 g/mol. IUPAC name: sodium 3-methyl-2-methylsulfanylpteridin-8-ide-4,7-dione. InChIKey: QFLSMXFKXUSKRP-UHFFFAOYSA-M.
| Molecular formula | C8H7N4NaO2S |
|---|---|
| Molecular weight | 246.22 g/mol |
| IUPAC name | sodium 3-methyl-2-methylsulfanylpteridin-8-ide-4,7-dione |
| InChIKey | QFLSMXFKXUSKRP-UHFFFAOYSA-M |
| SMILES | CN1C(=O)C2=C([N-]C(=O)C=N2)N=C1SC.[Na+] |
Computed by PubChem (NCBI)