CAS 1998216-17-3 is the registry number for Fmoc-L-Aph(tBuCbm)-OH 97%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.
(2S)-3-[4-(tert-butylcarbamoylamino)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 1998216-17-3) is a chemical compound with the molecular formula C29H31N3O5 and a molecular weight of 501.6 g/mol. IUPAC name: (2S)-3-[4-(tert-butylcarbamoylamino)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: ZDEKLTOYUSVJAK-VWLOTQADSA-N.
| Molecular formula | C29H31N3O5 |
|---|---|
| Molecular weight | 501.6 g/mol |
| IUPAC name | (2S)-3-[4-(tert-butylcarbamoylamino)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | ZDEKLTOYUSVJAK-VWLOTQADSA-N |
| SMILES | CC(C)(C)NC(=O)NC1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)