CAS 1998216-27-5 appears in our catalog under these names: tert-Butyl 3-hydrazinylazetidine-1-carboxylate hydrochloride, 97%, tert-Butyl 3-hydrazinylazetidine-1-carboxylate hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
Tert-butyl 3-hydrazinylazetidine-1-carboxylate;hydrochloride (CAS 1998216-27-5) is a chemical compound with the molecular formula C8H18ClN3O2 and a molecular weight of 223.70 g/mol. IUPAC name: tert-butyl 3-hydrazinylazetidine-1-carboxylate;hydrochloride. InChIKey: JJDZGMYQGLEKFR-UHFFFAOYSA-N.
| Molecular formula | C8H18ClN3O2 |
|---|---|
| Molecular weight | 223.70 g/mol |
| IUPAC name | tert-butyl 3-hydrazinylazetidine-1-carboxylate;hydrochloride |
| InChIKey | JJDZGMYQGLEKFR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)NN.Cl |
Computed by PubChem (NCBI)