CAS 1998216-43-5 is the registry number for N-(6-Acetylnaphthalen-2-yl)-2-nitrobenzenesulfonamide, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(6-acetylnaphthalen-2-yl)-2-nitrobenzenesulfonamide (CAS 1998216-43-5) is a chemical compound with the molecular formula C18H14N2O5S and a molecular weight of 370.4 g/mol. IUPAC name: N-(6-acetylnaphthalen-2-yl)-2-nitrobenzenesulfonamide. InChIKey: CMSZFCSRABYINY-UHFFFAOYSA-N.
| Molecular formula | C18H14N2O5S |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | N-(6-acetylnaphthalen-2-yl)-2-nitrobenzenesulfonamide |
| InChIKey | CMSZFCSRABYINY-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)C=C(C=C2)NS(=O)(=O)C3=CC=CC=C3[N+](=O)[O-] |
Computed by PubChem (NCBI)