CAS 199863-81-5 appears in our catalog under these names: 4-(tert-Butyl)-6-chloropyrimidin-2-amine, 98%, 4-tert-Butyl-6-chloropyrimidin-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-tert-butyl-6-chloropyrimidin-2-amine (CAS 199863-81-5) is a chemical compound with the molecular formula C8H12ClN3 and a molecular weight of 185.65 g/mol. IUPAC name: 4-tert-butyl-6-chloropyrimidin-2-amine. InChIKey: NHLBQXLNPWUMCI-UHFFFAOYSA-N.
| Molecular formula | C8H12ClN3 |
|---|---|
| Molecular weight | 185.65 g/mol |
| IUPAC name | 4-tert-butyl-6-chloropyrimidin-2-amine |
| InChIKey | NHLBQXLNPWUMCI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=NC(=N1)N)Cl |
Computed by PubChem (NCBI)