CAS 199864-86-3 appears in our catalog under these names: 4-(4-Fluoronaphthalen-1-yl)-6-isopropylpyrimidin-2-amine hydrochloride, 95%, RS 127445 hydrochloride, RS-127445 hydrochloride/ 98%, RS-127445 Hydrochloride, >98.0%(HPLC), RS 127445 hydrochloride. Offered by: Combi-blocks, GLPBio, TargetMol, TCI, Biosynth. Available pack sizes: 10mg, 50mg, 5mg, 25mg, 100mg, 200mg, 50 mg, 100 mg.
4-(4-fluoronaphthalen-1-yl)-6-propan-2-ylpyrimidin-2-amine;hydrochloride (CAS 199864-86-3) is a chemical compound with the molecular formula C17H17ClFN3 and a molecular weight of 317.8 g/mol. IUPAC name: 4-(4-fluoronaphthalen-1-yl)-6-propan-2-ylpyrimidin-2-amine;hydrochloride. InChIKey: MKJPYBJBPRFMHL-UHFFFAOYSA-N.
| Molecular formula | C17H17ClFN3 |
|---|---|
| Molecular weight | 317.8 g/mol |
| IUPAC name | 4-(4-fluoronaphthalen-1-yl)-6-propan-2-ylpyrimidin-2-amine;hydrochloride |
| InChIKey | MKJPYBJBPRFMHL-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC(=NC(=C1)C2=CC=C(C3=CC=CC=C32)F)N.Cl |
Computed by PubChem (NCBI)