Products 1998640-03-1
CAS 1998640-03-1 is the registry number for Fmoc-L-Ala(2,3-dihydro-1-benzofuran-5-yl)-OH. Offered by: Iris Biotech. Available pack sizes: 250mg, 1g, 5g.
(2S)-3-(2,3-dihydro-1-benzofuran-5-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 1998640-03-1) is a chemical compound with the molecular formula C26H23NO5 and a molecular weight of 429.5 g/mol. IUPAC name: (2S)-3-(2,3-dihydro-1-benzofuran-5-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: HYSKHFNAORFINL-QHCPKHFHSA-N.
| Molecular formula | C26H23NO5 |
|---|---|
| Molecular weight | 429.5 g/mol |
| IUPAC name | (2S)-3-(2,3-dihydro-1-benzofuran-5-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | HYSKHFNAORFINL-QHCPKHFHSA-N |
| SMILES | C1COC2=C1C=C(C=C2)C[C@@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)