CAS 1998700-96-1 appears in our catalog under these names: H-D-Phe-amc hydrochloride, 95%, H-D-Phe-AMC.HCl, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 100mg.
(2R)-2-amino-N-(4-methyl-2-oxochromen-7-yl)-3-phenylpropanamide;hydrochloride (CAS 1998700-96-1) is a chemical compound with the molecular formula C19H19ClN2O3 and a molecular weight of 358.8 g/mol. IUPAC name: (2R)-2-amino-N-(4-methyl-2-oxochromen-7-yl)-3-phenylpropanamide;hydrochloride. InChIKey: DRCLWALSXXXJCV-PKLMIRHRSA-N.
| Molecular formula | C19H19ClN2O3 |
|---|---|
| Molecular weight | 358.8 g/mol |
| IUPAC name | (2R)-2-amino-N-(4-methyl-2-oxochromen-7-yl)-3-phenylpropanamide;hydrochloride |
| InChIKey | DRCLWALSXXXJCV-PKLMIRHRSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)[C@@H](CC3=CC=CC=C3)N.Cl |
Computed by PubChem (NCBI)