CAS 1998701-04-4 is the registry number for H-D-Phg-AMC.HCl, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-amino-N-(4-methyl-2-oxochromen-7-yl)-2-phenylacetamide;hydrochloride (CAS 1998701-04-4) is a chemical compound with the molecular formula C18H17ClN2O3 and a molecular weight of 344.8 g/mol. IUPAC name: (2R)-2-amino-N-(4-methyl-2-oxochromen-7-yl)-2-phenylacetamide;hydrochloride. InChIKey: OFDGQJISTJCYLQ-UNTBIKODSA-N.
| Molecular formula | C18H17ClN2O3 |
|---|---|
| Molecular weight | 344.8 g/mol |
| IUPAC name | (2R)-2-amino-N-(4-methyl-2-oxochromen-7-yl)-2-phenylacetamide;hydrochloride |
| InChIKey | OFDGQJISTJCYLQ-UNTBIKODSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)[C@@H](C3=CC=CC=C3)N.Cl |
Computed by PubChem (NCBI)