CAS 1998701-09-9 appears in our catalog under these names: (R)-tert-Butyl 2-(aminomethyl)morpholine-4-carboxylate acetate, 97%, (R)–tert–Butyl 2–(aminomethyl)morpholine–4–carboxylate acetate, (R)-tert-Butyl 2-(aminomethyl)morpholine-4-carboxylate acetate, 97%, 97%. Offered by: AmBeed, GLPBio, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg.
Acetic acid;tert-butyl (2R)-2-(aminomethyl)morpholine-4-carboxylate (CAS 1998701-09-9) is a chemical compound with the molecular formula C12H24N2O5 and a molecular weight of 276.33 g/mol. IUPAC name: acetic acid;tert-butyl (2R)-2-(aminomethyl)morpholine-4-carboxylate. InChIKey: RMRCEKSGXTWEQD-DDWIOCJRSA-N.
| Molecular formula | C12H24N2O5 |
|---|---|
| Molecular weight | 276.33 g/mol |
| IUPAC name | acetic acid;tert-butyl (2R)-2-(aminomethyl)morpholine-4-carboxylate |
| InChIKey | RMRCEKSGXTWEQD-DDWIOCJRSA-N |
| SMILES | CC(=O)O.CC(C)(C)OC(=O)N1CCO[C@@H](C1)CN |
Computed by PubChem (NCBI)