CAS 1999-64-0 appears in our catalog under these names: 6-Ethylnaphthalen-2-ol 98%, 6-Ethylnaphthalen-2-ol, 98%, 98%, 6-Ethyl-2-naphthalenol, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
6-ethylnaphthalen-2-ol (CAS 1999-64-0) is a chemical compound with the molecular formula C12H12O and a molecular weight of 172.22 g/mol. IUPAC name: 6-ethylnaphthalen-2-ol. InChIKey: UMFMPNDTINUJER-UHFFFAOYSA-N.
| Molecular formula | C12H12O |
|---|---|
| Molecular weight | 172.22 g/mol |
| IUPAC name | 6-ethylnaphthalen-2-ol |
| InChIKey | UMFMPNDTINUJER-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(C=C1)C=C(C=C2)O |
Computed by PubChem (NCBI)