CAS 19995-46-1 appears in our catalog under these names: 4-Nitrobenzo[b]thiophene-2-carboxylic acid, 95%, benzo(b)thiophene-2-carboxylic acid, 4-nitro-. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 100mg.
4-nitro-1-benzothiophene-2-carboxylic acid (CAS 19995-46-1) is a chemical compound with the molecular formula C9H5NO4S and a molecular weight of 223.21 g/mol. IUPAC name: 4-nitro-1-benzothiophene-2-carboxylic acid. InChIKey: VWBSZLRCSIQTCP-UHFFFAOYSA-N.
| Molecular formula | C9H5NO4S |
|---|---|
| Molecular weight | 223.21 g/mol |
| IUPAC name | 4-nitro-1-benzothiophene-2-carboxylic acid |
| InChIKey | VWBSZLRCSIQTCP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=C(SC2=C1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)