CAS 2001-94-7 appears in our catalog under these names: Dipotassium edta, 97%, Edetate Dipotassium Anhydrous, 98%, EDTa–K2, Dipotassium EDTA, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 5g, 100g, 1g, 25g, 2,5kg, 500g, 2.5kg.
Dipotassium;2-[2-[carboxylatomethyl(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetate (CAS 2001-94-7) is a chemical compound with the molecular formula C10H14K2N2O8 and a molecular weight of 368.42 g/mol. IUPAC name: dipotassium;2-[2-[carboxylatomethyl(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetate. InChIKey: QLBHNVFOQLIYTH-UHFFFAOYSA-L.
| Molecular formula | C10H14K2N2O8 |
|---|---|
| Molecular weight | 368.42 g/mol |
| IUPAC name | dipotassium;2-[2-[carboxylatomethyl(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetate |
| InChIKey | QLBHNVFOQLIYTH-UHFFFAOYSA-L |
| SMILES | C(CN(CC(=O)O)CC(=O)[O-])N(CC(=O)O)CC(=O)[O-].[K+].[K+] |
Computed by PubChem (NCBI)