CAS 2001041-35-4 is the registry number for 3',4'-Bis(4,4-dimethyl-4,5-dihydrooxazol-2-yl)-[1,1'-biphenyl]-4-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[3,4-bis(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]phenol (CAS 2001041-35-4) is a chemical compound with the molecular formula C22H24N2O3 and a molecular weight of 364.4 g/mol. IUPAC name: 4-[3,4-bis(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]phenol. InChIKey: FQTGRRRLKORLNI-UHFFFAOYSA-N.
| Molecular formula | C22H24N2O3 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 4-[3,4-bis(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]phenol |
| InChIKey | FQTGRRRLKORLNI-UHFFFAOYSA-N |
| SMILES | CC1(COC(=N1)C2=C(C=C(C=C2)C3=CC=C(C=C3)O)C4=NC(CO4)(C)C)C |
Computed by PubChem (NCBI)