CAS 2001051-99-4 is the registry number for Isavuconazole Impurity 63. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,3S)-3-(2,5-difluorophenyl)-3-hydroxy-2-methyl-4-(1,2,4-triazol-1-yl)butanenitrile (CAS 2001051-99-4) is a chemical compound with the molecular formula C13H12F2N4O and a molecular weight of 278.26 g/mol. IUPAC name: (2S,3S)-3-(2,5-difluorophenyl)-3-hydroxy-2-methyl-4-(1,2,4-triazol-1-yl)butanenitrile. InChIKey: SYSUFNUKZJVPBI-ZANVPECISA-N.
| Molecular formula | C13H12F2N4O |
|---|---|
| Molecular weight | 278.26 g/mol |
| IUPAC name | (2S,3S)-3-(2,5-difluorophenyl)-3-hydroxy-2-methyl-4-(1,2,4-triazol-1-yl)butanenitrile |
| InChIKey | SYSUFNUKZJVPBI-ZANVPECISA-N |
| SMILES | C[C@@H](C#N)[C@@](CN1C=NC=N1)(C2=C(C=CC(=C2)F)F)O |
Computed by PubChem (NCBI)