CAS 2001082-11-5 is the registry number for BI-7190. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[3-methoxy-4-[1-(4-methylpiperazin-1-yl)cyclopropyl]phenyl]-1,3,4-trimethylpyridin-2-one (CAS 2001082-11-5) is a chemical compound with the molecular formula C23H31N3O2 and a molecular weight of 381.5 g/mol. IUPAC name: 5-[3-methoxy-4-[1-(4-methylpiperazin-1-yl)cyclopropyl]phenyl]-1,3,4-trimethylpyridin-2-one. InChIKey: ASRLBLHATMXGPC-UHFFFAOYSA-N.
| Molecular formula | C23H31N3O2 |
|---|---|
| Molecular weight | 381.5 g/mol |
| IUPAC name | 5-[3-methoxy-4-[1-(4-methylpiperazin-1-yl)cyclopropyl]phenyl]-1,3,4-trimethylpyridin-2-one |
| InChIKey | ASRLBLHATMXGPC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(C=C1C2=CC(=C(C=C2)C3(CC3)N4CCN(CC4)C)OC)C)C |
Computed by PubChem (NCBI)