CAS 2001090-87-3 is the registry number for Mitochondrial-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(1S,3R)-3-(3-methylphenoxy)cyclohexyl]-N-(pyridin-4-ylmethyl)propan-1-amine (CAS 2001090-87-3) is a chemical compound with the molecular formula C22H30N2O and a molecular weight of 338.5 g/mol. IUPAC name: 2-[(1S,3R)-3-(3-methylphenoxy)cyclohexyl]-N-(pyridin-4-ylmethyl)propan-1-amine. InChIKey: BKSLMLGJKRCNCQ-DMYVWATESA-N.
| Molecular formula | C22H30N2O |
|---|---|
| Molecular weight | 338.5 g/mol |
| IUPAC name | 2-[(1S,3R)-3-(3-methylphenoxy)cyclohexyl]-N-(pyridin-4-ylmethyl)propan-1-amine |
| InChIKey | BKSLMLGJKRCNCQ-DMYVWATESA-N |
| SMILES | CC1=CC(=CC=C1)O[C@@H]2CCC[C@@H](C2)C(C)CNCC3=CC=NC=C3 |
Computed by PubChem (NCBI)