CAS 2001115-35-9 appears in our catalog under these names: Tris(4-(10H-phenoxazin-10-yl)phenyl)phosphane, 98%, Poly(9,9-n-dihexyl-2,7-fluorene-alt-9-phenyl-3,6-carbazole). Offered by: Chemat Brand, Lumtec. Available pack sizes: on request.
Tris(4-phenoxazin-10-ylphenyl)phosphane (CAS 2001115-35-9) is a chemical compound with the molecular formula C54H36N3O3P and a molecular weight of 805.9 g/mol. IUPAC name: tris(4-phenoxazin-10-ylphenyl)phosphane. InChIKey: JPYJSOTVAMRSFY-UHFFFAOYSA-N.
| Molecular formula | C54H36N3O3P |
|---|---|
| Molecular weight | 805.9 g/mol |
| IUPAC name | tris(4-phenoxazin-10-ylphenyl)phosphane |
| InChIKey | JPYJSOTVAMRSFY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N(C3=CC=CC=C3O2)C4=CC=C(C=C4)P(C5=CC=C(C=C5)N6C7=CC=CC=C7OC8=CC=CC=C86)C9=CC=C(C=C9)N1C2=CC=CC=C2OC2=CC=CC=C21 |
Computed by PubChem (NCBI)