CAS 200112-75-0 appears in our catalog under these names: 3-(Perfluorooctyl)propyl iodide, 95%, 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11–Heptadecafluoroundecyl iodide, 3-(Perfluorooctyl)propyliodide 98%, 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-&. Offered by: Combi-blocks, GLPBio, Ambeed, Sigma-Aldrich. Available pack sizes: 5g, 1g, 500g, 100mg, 250mg, 25g, 100g.
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoro-11-iodoundecane (CAS 200112-75-0) is a chemical compound with the molecular formula C11H6F17I and a molecular weight of 588.04 g/mol. IUPAC name: 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoro-11-iodoundecane. InChIKey: AXUBYTAXJHIPJO-UHFFFAOYSA-N.
| Molecular formula | C11H6F17I |
|---|---|
| Molecular weight | 588.04 g/mol |
| IUPAC name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoro-11-iodoundecane |
| InChIKey | AXUBYTAXJHIPJO-UHFFFAOYSA-N |
| SMILES | C(CC(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)CI |
Computed by PubChem (NCBI)