Products 200114-52-9
CAS 200114-52-9 is the registry number for H-D-Arg(Mtr)-OH. Offered by: Creative Peptides, Biosynth. Available pack sizes: 1g, 5g, 2g, 10g.
(2R)-2-amino-5-[[amino-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]methylidene]amino]pentanoic acid (CAS 200114-52-9) is a chemical compound with the molecular formula C16H26N4O5S and a molecular weight of 386.5 g/mol. IUPAC name: (2R)-2-amino-5-[[amino-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]methylidene]amino]pentanoic acid. InChIKey: FUSAEZSSVDNYPO-GFCCVEGCSA-N.
| Molecular formula | C16H26N4O5S |
|---|---|
| Molecular weight | 386.5 g/mol |
| IUPAC name | (2R)-2-amino-5-[[amino-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]methylidene]amino]pentanoic acid |
| InChIKey | FUSAEZSSVDNYPO-GFCCVEGCSA-N |
| SMILES | CC1=CC(=C(C(=C1S(=O)(=O)NC(=NCCC[C@H](C(=O)O)N)N)C)C)OC |
Computed by PubChem (NCBI)
Synonyms:
H-D-Arg(mtr)-OH, H-Arg(Mtr)-OH.H2O