CAS 2001565-28-0 is the registry number for N-(4-(2-Bromoacetyl)-3-chlorophenyl)methanesulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[4-(2-bromoacetyl)-3-chlorophenyl]methanesulfonamide (CAS 2001565-28-0) is a chemical compound with the molecular formula C9H9BrClNO3S and a molecular weight of 326.60 g/mol. IUPAC name: N-[4-(2-bromoacetyl)-3-chlorophenyl]methanesulfonamide. InChIKey: NSKUDKLCSLBRTL-UHFFFAOYSA-N.
| Molecular formula | C9H9BrClNO3S |
|---|---|
| Molecular weight | 326.60 g/mol |
| IUPAC name | N-[4-(2-bromoacetyl)-3-chlorophenyl]methanesulfonamide |
| InChIKey | NSKUDKLCSLBRTL-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=CC(=C(C=C1)C(=O)CBr)Cl |
Computed by PubChem (NCBI)