CAS 20017-49-6 is the registry number for Perfluoro(4-isopropyltoluene), 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
1,2,4,5-tetrafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)benzene (CAS 20017-49-6) is a chemical compound with the molecular formula C10F14 and a molecular weight of 386.08 g/mol. IUPAC name: 1,2,4,5-tetrafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)benzene. InChIKey: CKGPOWZUEZFLPG-UHFFFAOYSA-N.
| Molecular formula | C10F14 |
|---|---|
| Molecular weight | 386.08 g/mol |
| IUPAC name | 1,2,4,5-tetrafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)benzene |
| InChIKey | CKGPOWZUEZFLPG-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)C(F)(F)F)F)F)C(C(F)(F)F)(C(F)(F)F)F |
Computed by PubChem (NCBI)