Products 2001872-35-9
CAS 2001872-35-9 is the registry number for tert-Butyl 4-(3-bromobenzoyl)piperidine-1-carboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg.
Tert-butyl 4-(3-bromobenzoyl)piperidine-1-carboxylate (CAS 2001872-35-9) is a chemical compound with the molecular formula C17H22BrNO3 and a molecular weight of 368.3 g/mol. IUPAC name: tert-butyl 4-(3-bromobenzoyl)piperidine-1-carboxylate. InChIKey: RHGQZOVYBMMPHF-UHFFFAOYSA-N.
| Molecular formula | C17H22BrNO3 |
|---|---|
| Molecular weight | 368.3 g/mol |
| IUPAC name | tert-butyl 4-(3-bromobenzoyl)piperidine-1-carboxylate |
| InChIKey | RHGQZOVYBMMPHF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C(=O)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)