CAS 2002529-20-4 is the registry number for (R)-2-N-Fmoc-3-(4-(dimethylamino)phenyl)propanoic acid 95%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
(2R)-3-[4-(dimethylamino)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 2002529-20-4) is a chemical compound with the molecular formula C26H26N2O4 and a molecular weight of 430.5 g/mol. IUPAC name: (2R)-3-[4-(dimethylamino)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: TWNGBHYOIMBXEN-XMMPIXPASA-N.
| Molecular formula | C26H26N2O4 |
|---|---|
| Molecular weight | 430.5 g/mol |
| IUPAC name | (2R)-3-[4-(dimethylamino)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | TWNGBHYOIMBXEN-XMMPIXPASA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C[C@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)