Products 360575-05-9
CAS 360575-05-9 is the registry number for tert–Butyl (S)–2–((diphenylmethylene)amino)–3–(2–nitrophenyl)propanoate. Offered by: GLPBio. Available pack sizes: 1g.
Tert-butyl (2S)-2-(benzhydrylideneamino)-3-(2-nitrophenyl)propanoate (CAS 360575-05-9) is a chemical compound with the molecular formula C26H26N2O4 and a molecular weight of 430.5 g/mol. IUPAC name: tert-butyl (2S)-2-(benzhydrylideneamino)-3-(2-nitrophenyl)propanoate. InChIKey: BFPBLCWCTCSUCW-QFIPXVFZSA-N.
| Molecular formula | C26H26N2O4 |
|---|---|
| Molecular weight | 430.5 g/mol |
| IUPAC name | tert-butyl (2S)-2-(benzhydrylideneamino)-3-(2-nitrophenyl)propanoate |
| InChIKey | BFPBLCWCTCSUCW-QFIPXVFZSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CC1=CC=CC=C1[N+](=O)[O-])N=C(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)