CAS 2003234-64-6 appears in our catalog under these names: (S)-GNE-140, (S)-GNE-140, 99%, (S)–GNE–140, (S)-gne-140, 99.07%, 99.07%, (S)-GNE-140, 99.30%. Offered by: TRC, AmBeed, GLPBio, Chemat, MedChemExpress. Available pack sizes: 25mg, 100mg, 1mg, 10mg, 10mM (in 1ml dmso), 5mg, 50mg, 100 mg.
(2S)-5-(2-chlorophenyl)sulfanyl-4-hydroxy-2-(4-morpholin-4-ylphenyl)-2-thiophen-3-yl-1,3-dihydropyridin-6-one (CAS 2003234-64-6) is a chemical compound with the molecular formula C25H23ClN2O3S2 and a molecular weight of 499.0 g/mol. IUPAC name: (2S)-5-(2-chlorophenyl)sulfanyl-4-hydroxy-2-(4-morpholin-4-ylphenyl)-2-thiophen-3-yl-1,3-dihydropyridin-6-one. InChIKey: SUFXXEIVBZJOAP-VWLOTQADSA-N.
| Molecular formula | C25H23ClN2O3S2 |
|---|---|
| Molecular weight | 499.0 g/mol |
| IUPAC name | (2S)-5-(2-chlorophenyl)sulfanyl-4-hydroxy-2-(4-morpholin-4-ylphenyl)-2-thiophen-3-yl-1,3-dihydropyridin-6-one |
| InChIKey | SUFXXEIVBZJOAP-VWLOTQADSA-N |
| SMILES | C1COCCN1C2=CC=C(C=C2)[C@@]3(CC(=C(C(=O)N3)SC4=CC=CC=C4Cl)O)C5=CSC=C5 |
Computed by PubChem (NCBI)