CAS 200335-75-7 appears in our catalog under these names: Fmoc-d-asp(otbu)-opfp, 95%, Fmoc-D-Asp(OtBu)-Opfp, 98+%, Fmoc–D–Asp(OtBu)–Opfp, Fmoc-D-Asp(OtBu)-Opfp. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 250mg, 10g, 5g, 1g, 25g, 500mg, 1000mg, 2000mg.
4-O-tert-butyl 1-O-(2,3,4,5,6-pentafluorophenyl) (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanedioate (CAS 200335-75-7) is a chemical compound with the molecular formula C29H24F5NO6 and a molecular weight of 577.5 g/mol. IUPAC name: 4-O-tert-butyl 1-O-(2,3,4,5,6-pentafluorophenyl) (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanedioate. InChIKey: DWYWJUBBXKYAMY-LJQANCHMSA-N.
| Molecular formula | C29H24F5NO6 |
|---|---|
| Molecular weight | 577.5 g/mol |
| IUPAC name | 4-O-tert-butyl 1-O-(2,3,4,5,6-pentafluorophenyl) (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanedioate |
| InChIKey | DWYWJUBBXKYAMY-LJQANCHMSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@H](C(=O)OC1=C(C(=C(C(=C1F)F)F)F)F)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)