CAS 200397-60-0 appears in our catalog under these names: Boc-d-glu(otbu)-onp, 95%, Boc-D-Glu(tBu)-ONp, 95+%, Boc–D–Glu(OtBu)–ONp. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 5g, 250mg, 25g.
5-O-tert-butyl 1-O-(4-nitrophenyl) (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate (CAS 200397-60-0) is a chemical compound with the molecular formula C20H28N2O8 and a molecular weight of 424.4 g/mol. IUPAC name: 5-O-tert-butyl 1-O-(4-nitrophenyl) (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate. InChIKey: XGSZKZYRDFXIHX-OAHLLOKOSA-N.
| Molecular formula | C20H28N2O8 |
|---|---|
| Molecular weight | 424.4 g/mol |
| IUPAC name | 5-O-tert-butyl 1-O-(4-nitrophenyl) (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
| InChIKey | XGSZKZYRDFXIHX-OAHLLOKOSA-N |
| SMILES | CC(C)(C)OC(=O)CC[C@H](C(=O)OC1=CC=C(C=C1)[N+](=O)[O-])NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)