CAS 200425-75-8 appears in our catalog under these names: (1S)-6-Methoxy-2,3-dihydro-1H-inden-1-ol, 95%, (1S)-6-Methoxy-2,3-dihydro-1H-inden-1-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
(1S)-6-methoxy-2,3-dihydro-1H-inden-1-ol (CAS 200425-75-8) is a chemical compound with the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. IUPAC name: (1S)-6-methoxy-2,3-dihydro-1H-inden-1-ol. InChIKey: IAVGAIAOOXUVAD-JTQLQIEISA-N.
| Molecular formula | C10H12O2 |
|---|---|
| Molecular weight | 164.20 g/mol |
| IUPAC name | (1S)-6-methoxy-2,3-dihydro-1H-inden-1-ol |
| InChIKey | IAVGAIAOOXUVAD-JTQLQIEISA-N |
| SMILES | COC1=CC2=C(CC[C@@H]2O)C=C1 |
Computed by PubChem (NCBI)