CAS 200427-88-9 appears in our catalog under these names: Gly–Gly–Phe–Gly, Gly-Gly-Phe-Gly, 99.51%, (S)-2-(2-(2-(2-Aminoacetamido)acetamido)-3-phenylpropanamido)acetic acid, 97%, 97%, Gly-Gly-Phe-Gly, 98%. Offered by: GLPBio, MedChemExpress, Chemat, Fluorochem. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg, 100 mg, 10 mg, 50 mg.
2-[[(2S)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-phenylpropanoyl]amino]acetic acid (CAS 200427-88-9) is a chemical compound with the molecular formula C15H20N4O5 and a molecular weight of 336.34 g/mol. IUPAC name: 2-[[(2S)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-phenylpropanoyl]amino]acetic acid. InChIKey: HXUVTXPOZRFMOY-NSHDSACASA-N.
| Molecular formula | C15H20N4O5 |
|---|---|
| Molecular weight | 336.34 g/mol |
| IUPAC name | 2-[[(2S)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-phenylpropanoyl]amino]acetic acid |
| InChIKey | HXUVTXPOZRFMOY-NSHDSACASA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)NCC(=O)O)NC(=O)CNC(=O)CN |
Computed by PubChem (NCBI)