CAS 2004449-10-7 is the registry number for 1,1-Dimethylethyl 3-(4-bromo-2,3-difluorophenyl)-3-hydroxy-1-azetidinecarboxy..., 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Tert-butyl 3-(4-bromo-2,3-difluorophenyl)-3-hydroxyazetidine-1-carboxylate (CAS 2004449-10-7) is a chemical compound with the molecular formula C14H16BrF2NO3 and a molecular weight of 364.18 g/mol. IUPAC name: tert-butyl 3-(4-bromo-2,3-difluorophenyl)-3-hydroxyazetidine-1-carboxylate. InChIKey: HFIBCCXTVMIILP-UHFFFAOYSA-N.
| Molecular formula | C14H16BrF2NO3 |
|---|---|
| Molecular weight | 364.18 g/mol |
| IUPAC name | tert-butyl 3-(4-bromo-2,3-difluorophenyl)-3-hydroxyazetidine-1-carboxylate |
| InChIKey | HFIBCCXTVMIILP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)(C2=C(C(=C(C=C2)Br)F)F)O |
Computed by PubChem (NCBI)