Products 2004678-18-4
CAS 2004678-18-4 is the registry number for 3-amino-6-chloro-4-methylpyridine-2-carboxamide, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g.
3-amino-6-chloro-4-methylpyridine-2-carboxamide (CAS 2004678-18-4) is a chemical compound with the molecular formula C7H8ClN3O and a molecular weight of 185.61 g/mol. IUPAC name: 3-amino-6-chloro-4-methylpyridine-2-carboxamide. InChIKey: HCQMBABGHMBOBI-UHFFFAOYSA-N.
| Molecular formula | C7H8ClN3O |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | 3-amino-6-chloro-4-methylpyridine-2-carboxamide |
| InChIKey | HCQMBABGHMBOBI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=C1N)C(=O)N)Cl |
Computed by PubChem (NCBI)