CAS 2004679-56-3 appears in our catalog under these names: (R)-2-(((R)-2-hydroxy-1-phenylethyl)amino)-2-methylhexan-1-ol, 98%, (R)–2–(((R)–2–Hydroxy–1–phenylethyl)amino)–2–methylhexan–1–ol. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 100mg, 25mg.
(2R)-2-[[(1R)-2-hydroxy-1-phenylethyl]amino]-2-methylhexan-1-ol (CAS 2004679-56-3) is a chemical compound with the molecular formula C15H25NO2 and a molecular weight of 251.36 g/mol. IUPAC name: (2R)-2-[[(1R)-2-hydroxy-1-phenylethyl]amino]-2-methylhexan-1-ol. InChIKey: SQDCHJZVMOXCFC-LSDHHAIUSA-N.
| Molecular formula | C15H25NO2 |
|---|---|
| Molecular weight | 251.36 g/mol |
| IUPAC name | (2R)-2-[[(1R)-2-hydroxy-1-phenylethyl]amino]-2-methylhexan-1-ol |
| InChIKey | SQDCHJZVMOXCFC-LSDHHAIUSA-N |
| SMILES | CCCC[C@](C)(CO)N[C@@H](CO)C1=CC=CC=C1 |
Computed by PubChem (NCBI)