Products 2004734-94-3
CAS 2004734-94-3 is the registry number for 6-(1-Hexyn-1-yl)-1,3-dioxo-1H-benz[de]isoquinolin-2(3H)-yl 1,1,1-trifluoromethanesulfonate, 98%. Offered by: Chemat. Available pack sizes: 25g, 100g.
(6-hex-1-ynyl-1,3-dioxobenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate (CAS 2004734-94-3) is a chemical compound with the molecular formula C19H14F3NO5S and a molecular weight of 425.4 g/mol. IUPAC name: (6-hex-1-ynyl-1,3-dioxobenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate. InChIKey: CLYAXNKUZIWYJH-UHFFFAOYSA-N.
| Molecular formula | C19H14F3NO5S |
|---|---|
| Molecular weight | 425.4 g/mol |
| IUPAC name | (6-hex-1-ynyl-1,3-dioxobenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate |
| InChIKey | CLYAXNKUZIWYJH-UHFFFAOYSA-N |
| SMILES | CCCCC#CC1=C2C=CC=C3C2=C(C=C1)C(=O)N(C3=O)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)