CAS 20049-44-9 is the registry number for Nor-SCH-12679 (maleate). Offered by: MedChemExpress. Available pack sizes: Get quote.
(Z)-but-2-enedioic acid;7,8-dimethoxy-5-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepine (CAS 20049-44-9) is a chemical compound with the molecular formula C22H25NO6 and a molecular weight of 399.4 g/mol. IUPAC name: (Z)-but-2-enedioic acid;7,8-dimethoxy-5-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepine. InChIKey: BYWOXZMISCSWBQ-BTJKTKAUSA-N.
| Molecular formula | C22H25NO6 |
|---|---|
| Molecular weight | 399.4 g/mol |
| IUPAC name | (Z)-but-2-enedioic acid;7,8-dimethoxy-5-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepine |
| InChIKey | BYWOXZMISCSWBQ-BTJKTKAUSA-N |
| SMILES | COC1=C(C=C2C(CNCCC2=C1)C3=CC=CC=C3)OC.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)