CAS 200501-96-8 is the registry number for 1,1,1,2-Tetrafluoro-2-trifluoromethoxy-4-iodobutane, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 100g, 1g.
1,1,1,2-tetrafluoro-4-iodo-2-(trifluoromethoxy)butane (CAS 200501-96-8) is a chemical compound with the molecular formula C5H4F7IO and a molecular weight of 339.98 g/mol. IUPAC name: 1,1,1,2-tetrafluoro-4-iodo-2-(trifluoromethoxy)butane. InChIKey: HNXWCMICEMCXCV-UHFFFAOYSA-N.
| Molecular formula | C5H4F7IO |
|---|---|
| Molecular weight | 339.98 g/mol |
| IUPAC name | 1,1,1,2-tetrafluoro-4-iodo-2-(trifluoromethoxy)butane |
| InChIKey | HNXWCMICEMCXCV-UHFFFAOYSA-N |
| SMILES | C(CI)C(C(F)(F)F)(OC(F)(F)F)F |
Computed by PubChem (NCBI)